C15H24O — CID 6365621
(5E,7E)-8,12-dimethyltrideca-5,7,11-trien-4-one (PubChem CID 6365621) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (5E,7E)-8,12-dimethyltrideca-5,7,11-trien-4-one.
| Compound Name | (5E,7E)-8,12-dimethyltrideca-5,7,11-trien-4-one |
|---|---|
| PubChem CID | 6365621 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (5E,7E)-8,12-dimethyltrideca-5,7,11-trien-4-one |
| SMILES | CCCC(=O)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H24O/c1-5-8-15(16)12-7-11-14(4)10-6-9-13(2)3/h7,9,11-12H,5-6,8,10H2,1-4H3/b12-7+,14-11+ |
| InChIKey | WSEVLUFENBPOSN-XUIQRUTDSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|