C14H19F2N3O — CID 63656584
N-(cyclopentylmethyl)-3,5-difluoro-4-hydrazinyl-N-methylbenzamide (PubChem CID 63656584) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-3,5-difluoro-4-hydrazinyl-N-methylbenzamide.
| Compound Name | N-(cyclopentylmethyl)-3,5-difluoro-4-hydrazinyl-N-methylbenzamide |
|---|---|
| PubChem CID | 63656584 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(cyclopentylmethyl)-3,5-difluoro-4-hydrazinyl-N-methylbenzamide |
| SMILES | CN(CC1CCCC1)C(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C14H19F2N3O/c1-19(8-9-4-2-3-5-9)14(20)10-6-11(15)13(18-17)12(16)7-10/h6-7,9,18H,2-5,8,17H2,1H3 |
| InChIKey | JIBFKPKIHLQGGV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|