About (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene
(2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene (PubChem CID 6365670) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene.
Molecular Properties
| Compound Name | (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene |
| PubChem CID | 6365670 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene |
| SMILES | COCOC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H22O2/c1-11(2)6-5-7-12(3)8-9-14-10-13-4/h6,8H,5,7,9-10H2,1-4H3/b12-8+ |
| InChIKey | SAKWOVITFRSKER-XYOKQWHBSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene?
The IUPAC name of (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene (CID 6365670) is (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene.
What is the SMILES notation for (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene?
The canonical SMILES for (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene is COCOC/C=C(\C)CCC=C(C)C.
What is the InChIKey of (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene?
The InChIKey is SAKWOVITFRSKER-XYOKQWHBSA-N. The full InChI is InChI=1S/C12H22O2/c1-11(2)6-5-7-12(3)8-9-14-10-13-4/h6,8H,5,7,9-10H2,1-4H3/b12-8+.
What are the key properties of (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene?
(2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene has a molecular weight of 198.31 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-(methoxymethoxy)-3,7-dimethylocta-2,6-diene is sourced from PubChem (CID 6365670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).