About 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline
2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline (PubChem CID 63657227) has the molecular formula C12H13FN2OS
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline |
| PubChem CID | 63657227 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline |
| SMILES | CCOc1cc(F)ccc1NCc1nccs1 |
| InChI | InChI=1S/C12H13FN2OS/c1-2-16-11-7-9(13)3-4-10(11)15-8-12-14-5-6-17-12/h3-7,15H,2,8H2,1H3 |
| InChIKey | GWWUZVUANAPRKG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline?
The IUPAC name of 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline (CID 63657227) is 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline.
What is the SMILES notation for 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline?
The canonical SMILES for 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline is CCOc1cc(F)ccc1NCc1nccs1.
What is the InChIKey of 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline?
The InChIKey is GWWUZVUANAPRKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2OS/c1-2-16-11-7-9(13)3-4-10(11)15-8-12-14-5-6-17-12/h3-7,15H,2,8H2,1H3.
What are the key properties of 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline?
2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline has a molecular weight of 252.31 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-fluoro-N-(1,3-thiazol-2-ylmethyl)aniline is sourced from PubChem (CID 63657227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).