C18H26O — CID 63657471
1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ol (PubChem CID 63657471) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ol.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ol |
|---|---|
| PubChem CID | 63657471 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ol |
| SMILES | C#CCCC(O)Cc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C18H26O/c1-7-8-9-16(19)12-17-13(2)10-15(11-14(17)3)18(4,5)6/h1,10-11,16,19H,8-9,12H2,2-6H3 |
| InChIKey | WZNPWOHNPOTJMN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|