About octyl (E)-2-methylbut-2-enoate
octyl (E)-2-methylbut-2-enoate (PubChem CID 6365870) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is octyl (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | octyl (E)-2-methylbut-2-enoate |
| PubChem CID | 6365870 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | octyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C13H24O2/c1-4-6-7-8-9-10-11-15-13(14)12(3)5-2/h5H,4,6-11H2,1-3H3/b12-5+ |
| InChIKey | JNHPLASQNDHBJH-LFYBBSHMSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze octyl (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl (E)-2-methylbut-2-enoate?
The IUPAC name of octyl (E)-2-methylbut-2-enoate (CID 6365870) is octyl (E)-2-methylbut-2-enoate.
What is the SMILES notation for octyl (E)-2-methylbut-2-enoate?
The canonical SMILES for octyl (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)OCCCCCCCC.
What is the InChIKey of octyl (E)-2-methylbut-2-enoate?
The InChIKey is JNHPLASQNDHBJH-LFYBBSHMSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-6-7-8-9-10-11-15-13(14)12(3)5-2/h5H,4,6-11H2,1-3H3/b12-5+.
What are the key properties of octyl (E)-2-methylbut-2-enoate?
octyl (E)-2-methylbut-2-enoate has a molecular weight of 212.33 g/mol, XLogP of 3.86, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octyl (E)-2-methylbut-2-enoate is sourced from PubChem (CID 6365870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).