About 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile
5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile (PubChem CID 63658742) has the molecular formula C8H4N4S2
and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile |
| PubChem CID | 63658742 |
| Molecular Formula | C8H4N4S2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Sc2nccs2)cn1 |
| InChI | InChI=1S/C8H4N4S2/c9-3-6-4-12-7(5-11-6)14-8-10-1-2-13-8/h1-2,4-5H |
| InChIKey | NHYDBHBTLVIAPF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile?
The IUPAC name of 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile (CID 63658742) is 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile.
What is the SMILES notation for 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile?
The canonical SMILES for 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile is N#Cc1cnc(Sc2nccs2)cn1.
What is the InChIKey of 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile?
The InChIKey is NHYDBHBTLVIAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4S2/c9-3-6-4-12-7(5-11-6)14-8-10-1-2-13-8/h1-2,4-5H.
What are the key properties of 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile?
5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile has a molecular weight of 220.28 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carbonitrile is sourced from PubChem (CID 63658742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).