C12H17FN2O4S2 — CID 63659415
N-(5-amino-2-fluorophenyl)-2-(2-methylsulfonylethylsulfinyl)propanamide (PubChem CID 63659415) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-(2-methylsulfonylethylsulfinyl)propanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-(2-methylsulfonylethylsulfinyl)propanamide |
|---|---|
| PubChem CID | 63659415 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-(2-methylsulfonylethylsulfinyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(N)ccc1F)S(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H17FN2O4S2/c1-8(20(17)5-6-21(2,18)19)12(16)15-11-7-9(14)3-4-10(11)13/h3-4,7-8H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | LBDJADKQHZQYNE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|