C11H9ClN2O5S — CID 63659636
(4R)-3-(2-chloro-6-nitrobenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63659636) has the molecular formula C11H9ClN2O5S and a molecular weight of 316.72 g/mol. Its IUPAC name is (4R)-3-(2-chloro-6-nitrobenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(2-chloro-6-nitrobenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63659636 |
| Molecular Formula | C11H9ClN2O5S |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (4R)-3-(2-chloro-6-nitrobenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1C(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9ClN2O5S/c12-6-2-1-3-7(14(18)19)9(6)10(15)13-5-20-4-8(13)11(16)17/h1-3,8H,4-5H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | CVDWPJVEFQTBHD-QMMMGPOBSA-N |
| XLogP | 1.85 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|