About [(E)-hex-2-enyl] 2-hydroxypropanoate
[(E)-hex-2-enyl] 2-hydroxypropanoate (PubChem CID 6366079) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is [(E)-hex-2-enyl] 2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(E)-hex-2-enyl] 2-hydroxypropanoate |
| PubChem CID | 6366079 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(E)-hex-2-enyl] 2-hydroxypropanoate |
| SMILES | CCC/C=C/COC(=O)C(C)O |
| InChI | InChI=1S/C9H16O3/c1-3-4-5-6-7-12-9(11)8(2)10/h5-6,8,10H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | CLRYHPFNHRAPPN-AATRIKPKSA-N |
| XLogP | 1.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-2-enyl] 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-2-enyl] 2-hydroxypropanoate?
The IUPAC name of [(E)-hex-2-enyl] 2-hydroxypropanoate (CID 6366079) is [(E)-hex-2-enyl] 2-hydroxypropanoate.
What is the SMILES notation for [(E)-hex-2-enyl] 2-hydroxypropanoate?
The canonical SMILES for [(E)-hex-2-enyl] 2-hydroxypropanoate is CCC/C=C/COC(=O)C(C)O.
What is the InChIKey of [(E)-hex-2-enyl] 2-hydroxypropanoate?
The InChIKey is CLRYHPFNHRAPPN-AATRIKPKSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-4-5-6-7-12-9(11)8(2)10/h5-6,8,10H,3-4,7H2,1-2H3/b6-5+.
What are the key properties of [(E)-hex-2-enyl] 2-hydroxypropanoate?
[(E)-hex-2-enyl] 2-hydroxypropanoate has a molecular weight of 172.22 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-2-enyl] 2-hydroxypropanoate is sourced from PubChem (CID 6366079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).