C9H13F3N2O3 — CID 63661158
2,2,2-trifluoroethyl 2-ethyl-3-oxopiperazine-1-carboxylate (PubChem CID 63661158) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-ethyl-3-oxopiperazine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-ethyl-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 63661158 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-ethyl-3-oxopiperazine-1-carboxylate |
| SMILES | CCC1C(=O)NCCN1C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3/c1-2-6-7(15)13-3-4-14(6)8(16)17-5-9(10,11)12/h6H,2-5H2,1H3,(H,13,15) |
| InChIKey | KKQCRTASRVQXDP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |