C14H17F3N2O — CID 63661532
5-[(3,3,3-trifluoro-1-phenylpropyl)amino]piperidin-2-one (PubChem CID 63661532) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 5-[(3,3,3-trifluoro-1-phenylpropyl)amino]piperidin-2-one.
| Compound Name | 5-[(3,3,3-trifluoro-1-phenylpropyl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 63661532 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-[(3,3,3-trifluoro-1-phenylpropyl)amino]piperidin-2-one |
| SMILES | O=C1CCC(NC(CC(F)(F)F)c2ccccc2)CN1 |
| InChI | InChI=1S/C14H17F3N2O/c15-14(16,17)8-12(10-4-2-1-3-5-10)19-11-6-7-13(20)18-9-11/h1-5,11-12,19H,6-9H2,(H,18,20) |
| InChIKey | BBWCVMWWQRFKEM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |