C24H30O13 — CID 636616
1-[1,5-dihydroxy-3-methyl-8-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalen-2-yl]ethanone (PubChem CID 636616) has the molecular formula C24H30O13 and a molecular weight of 526.49 g/mol. Its IUPAC name is 1-[1,5-dihydroxy-3-methyl-8-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalen-2-yl]ethanone.
| Compound Name | 1-[1,5-dihydroxy-3-methyl-8-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 636616 |
| Molecular Formula | C24H30O13 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 1-[1,5-dihydroxy-3-methyl-8-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxynaphthalen-2-yl]ethanone |
| SMILES | CC(=O)c1c(C)cc2c(O)ccc(O[C@H]3O[C@H](CO[C@H]4OC[C@H](O)[C@H](O)[C@H]4O)[C@H](O)[C@H](O)[C@H]3O)c2c1O |
| InChI | InChI=1S/C24H30O13/c1-8-5-10-11(26)3-4-13(16(10)19(30)15(8)9(2)25)36-24-22(33)20(31)18(29)14(37-24)7-35-23-21(32)17(28)12(27)6-34-23/h3-5,12,14,17-18,20-24,26-33H,6-7H2,1-2H3/t12-,14+,17-,18-,20-,21+,22+,23+,24-/m0/s1 |
| InChIKey | PXPMKWLZBSCHGL-ZUYGJWCISA-N |
| XLogP | -1.60 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |