C30H54O3 — CID 6366339
8,8-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,6-dimethyloctan-2-ol (PubChem CID 6366339) has the molecular formula C30H54O3 and a molecular weight of 462.76 g/mol. Its IUPAC name is 8,8-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,6-dimethyloctan-2-ol.
| Compound Name | 8,8-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,6-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 6366339 |
| Molecular Formula | C30H54O3 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.41 |
| IUPAC Name | 8,8-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,6-dimethyloctan-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/COC(CC(C)CCCC(C)(C)O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H54O3/c1-24(2)13-10-15-26(5)18-21-32-29(23-28(7)17-12-20-30(8,9)31)33-22-19-27(6)16-11-14-25(3)4/h13-14,18-19,28-29,31H,10-12,15-17,20-23H2,1-9H3/b26-18+,27-19+ |
| InChIKey | HAECKZIOHXEQSO-BFNWXZRRSA-N |
| XLogP | 8.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|