C10H13N3O3S — CID 63663393
2-[1-(6-oxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 63663393) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[1-(6-oxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(6-oxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 63663393 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[1-(6-oxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nccn1C1CCC(=O)NC1 |
| InChI | InChI=1S/C10H13N3O3S/c14-8-2-1-7(5-12-8)13-4-3-11-10(13)17-6-9(15)16/h3-4,7H,1-2,5-6H2,(H,12,14)(H,15,16) |
| InChIKey | KQJQHBJIAQVVEF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |