About 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one
5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one (PubChem CID 63663485) has the molecular formula C10H18N2O3S
and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one.
Molecular Properties
| Compound Name | 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one |
| PubChem CID | 63663485 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one |
| SMILES | O=C1CCC(NC2CCS(=O)(=O)CC2)CN1 |
| InChI | InChI=1S/C10H18N2O3S/c13-10-2-1-9(7-11-10)12-8-3-5-16(14,15)6-4-8/h8-9,12H,1-7H2,(H,11,13) |
| InChIKey | IOBJZXZZSYOTBA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one?
The IUPAC name of 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one (CID 63663485) is 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one.
What is the SMILES notation for 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one?
The canonical SMILES for 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one is O=C1CCC(NC2CCS(=O)(=O)CC2)CN1.
What is the InChIKey of 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one?
The InChIKey is IOBJZXZZSYOTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3S/c13-10-2-1-9(7-11-10)12-8-3-5-16(14,15)6-4-8/h8-9,12H,1-7H2,(H,11,13).
What are the key properties of 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one?
5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one has a molecular weight of 246.33 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,1-dioxothian-4-yl)amino]piperidin-2-one is sourced from PubChem (CID 63663485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).