C16H31ClN2O — CID 63663822
1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-chloro-2,2-dimethylpropan-1-one (PubChem CID 63663822) has the molecular formula C16H31ClN2O and a molecular weight of 302.89 g/mol. Its IUPAC name is 1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-chloro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-chloro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 63663822 |
| Molecular Formula | C16H31ClN2O |
| Molecular Weight | 302.89 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-chloro-2,2-dimethylpropan-1-one |
| SMILES | CCCCN(C)CC1CCN(C(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C16H31ClN2O/c1-5-6-9-18(4)12-14-7-10-19(11-8-14)15(20)16(2,3)13-17/h14H,5-13H2,1-4H3 |
| InChIKey | BNIXMCDRTDHVMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|