C13H25ClN2O2 — CID 63663829
3-chloro-2,2-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)propanamide (PubChem CID 63663829) has the molecular formula C13H25ClN2O2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 63663829 |
| Molecular Formula | C13H25ClN2O2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C13H25ClN2O2/c1-12(2,9-14)11(17)15-10-13(3,4)16-5-7-18-8-6-16/h5-10H2,1-4H3,(H,15,17) |
| InChIKey | MTMMMDWYVPTXHR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|