C7H12ClF3N2O3S — CID 63663907
2-[chloromethylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide (PubChem CID 63663907) has the molecular formula C7H12ClF3N2O3S and a molecular weight of 296.70 g/mol. Its IUPAC name is 2-[chloromethylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[chloromethylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 63663907 |
| Molecular Formula | C7H12ClF3N2O3S |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-[chloromethylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(CC(F)(F)F)S(=O)(=O)CCl |
| InChI | InChI=1S/C7H12ClF3N2O3S/c1-12(2)6(14)3-13(4-7(9,10)11)17(15,16)5-8/h3-5H2,1-2H3 |
| InChIKey | DVVXIKRBFAJCIK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|