About (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide
(E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide (PubChem CID 6366408) has the molecular formula C22H43NO3
and a molecular weight of 369.59 g/mol. Its IUPAC name is (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide.
Molecular Properties
| Compound Name | (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide |
| PubChem CID | 6366408 |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.32 |
| IUPAC Name | (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C22H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)23(18-20-24)19-21-25/h9-10,24-25H,2-8,11-21H2,1H3/b10-9+ |
| InChIKey | LPMBTLLQQJBUOO-MDZDMXLPSA-N |
| XLogP | 4.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide?
The IUPAC name of (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide (CID 6366408) is (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide.
What is the SMILES notation for (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide?
The canonical SMILES for (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide is CCCCCCCC/C=C/CCCCCCCC(=O)N(CCO)CCO.
What is the InChIKey of (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide?
The InChIKey is LPMBTLLQQJBUOO-MDZDMXLPSA-N. The full InChI is InChI=1S/C22H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)23(18-20-24)19-21-25/h9-10,24-25H,2-8,11-21H2,1H3/b10-9+.
What are the key properties of (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide?
(E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide has a molecular weight of 369.59 g/mol, XLogP of 4.84, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-bis(2-hydroxyethyl)octadec-9-enamide is sourced from PubChem (CID 6366408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).