C22H41NO3 — CID 6366410
(9E,12E)-N,N-bis(2-hydroxyethyl)octadeca-9,12-dienamide (PubChem CID 6366410) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is (9E,12E)-N,N-bis(2-hydroxyethyl)octadeca-9,12-dienamide.
| Compound Name | (9E,12E)-N,N-bis(2-hydroxyethyl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 6366410 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | (9E,12E)-N,N-bis(2-hydroxyethyl)octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C22H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)23(18-20-24)19-21-25/h6-7,9-10,24-25H,2-5,8,11-21H2,1H3/b7-6+,10-9+ |
| InChIKey | CKNOIIXFUKKRIC-AVQMFFATSA-N |
| XLogP | 4.61 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|