C10H16ClF3N2O2 — CID 63664432
3-chloro-N,2,2-trimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide (PubChem CID 63664432) has the molecular formula C10H16ClF3N2O2 and a molecular weight of 288.70 g/mol. Its IUPAC name is 3-chloro-N,2,2-trimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide.
| Compound Name | 3-chloro-N,2,2-trimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 63664432 |
| Molecular Formula | C10H16ClF3N2O2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-chloro-N,2,2-trimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
| SMILES | CN(CC(=O)NCC(F)(F)F)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C10H16ClF3N2O2/c1-9(2,5-11)8(18)16(3)4-7(17)15-6-10(12,13)14/h4-6H2,1-3H3,(H,15,17) |
| InChIKey | BDMILQLLGMTYGX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|