C15H22ClNO3 — CID 63664640
3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanamide (PubChem CID 63664640) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63664640 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(C(C)NC(=O)C(C)(C)CCl)cc1OC |
| InChI | InChI=1S/C15H22ClNO3/c1-10(17-14(18)15(2,3)9-16)11-6-7-12(19-4)13(8-11)20-5/h6-8,10H,9H2,1-5H3,(H,17,18) |
| InChIKey | FKOLHKSPEBBCJZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|