C11H18ClF3N2O2 — CID 63665265
3-chloro-N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 63665265) has the molecular formula C11H18ClF3N2O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is 3-chloro-N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-chloro-N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 63665265 |
| Molecular Formula | C11H18ClF3N2O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-chloro-N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CN(C)C(=O)CN(CC(F)(F)F)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C11H18ClF3N2O2/c1-10(2,6-12)9(19)17(7-11(13,14)15)5-8(18)16(3)4/h5-7H2,1-4H3 |
| InChIKey | JSQQDEJXVAICES-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|