About 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide
1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide (PubChem CID 63665812) has the molecular formula C8H8ClN5O2S
and a molecular weight of 273.70 g/mol. Its IUPAC name is 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide |
| PubChem CID | 63665812 |
| Molecular Formula | C8H8ClN5O2S |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide |
| SMILES | O=S(=O)(CCl)Nc1cccnc1-n1cncn1 |
| InChI | InChI=1S/C8H8ClN5O2S/c9-4-17(15,16)13-7-2-1-3-11-8(7)14-6-10-5-12-14/h1-3,5-6,13H,4H2 |
| InChIKey | SOPZXJXFJGJPPW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide?
The IUPAC name of 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide (CID 63665812) is 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide.
What is the SMILES notation for 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide?
The canonical SMILES for 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide is O=S(=O)(CCl)Nc1cccnc1-n1cncn1.
What is the InChIKey of 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide?
The InChIKey is SOPZXJXFJGJPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN5O2S/c9-4-17(15,16)13-7-2-1-3-11-8(7)14-6-10-5-12-14/h1-3,5-6,13H,4H2.
What are the key properties of 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide?
1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide has a molecular weight of 273.70 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methanesulfonamide is sourced from PubChem (CID 63665812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).