About 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine
2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine (PubChem CID 63667204) has the molecular formula C16H19F2N3
and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine.
Molecular Properties
| Compound Name | 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine |
| PubChem CID | 63667204 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine |
| SMILES | CCn1c(C2CCCC2)nc(-c2cccc(F)c2F)c1N |
| InChI | InChI=1S/C16H19F2N3/c1-2-21-15(19)14(11-8-5-9-12(17)13(11)18)20-16(21)10-6-3-4-7-10/h5,8-10H,2-4,6-7,19H2,1H3 |
| InChIKey | NCABERGDSOYVPC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine?
The IUPAC name of 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine (CID 63667204) is 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine.
What is the SMILES notation for 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine?
The canonical SMILES for 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine is CCn1c(C2CCCC2)nc(-c2cccc(F)c2F)c1N.
What is the InChIKey of 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine?
The InChIKey is NCABERGDSOYVPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3/c1-2-21-15(19)14(11-8-5-9-12(17)13(11)18)20-16(21)10-6-3-4-7-10/h5,8-10H,2-4,6-7,19H2,1H3.
What are the key properties of 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine?
2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine has a molecular weight of 291.34 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-5-(2,3-difluorophenyl)-3-ethylimidazol-4-amine is sourced from PubChem (CID 63667204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).