C10H11F2N — CID 63667541
5,6-difluoro-3-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 63667541) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 5,6-difluoro-3-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5,6-difluoro-3-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 63667541 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5,6-difluoro-3-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1Cc2c(ccc(F)c2F)CN1 |
| InChI | InChI=1S/C10H11F2N/c1-6-4-8-7(5-13-6)2-3-9(11)10(8)12/h2-3,6,13H,4-5H2,1H3 |
| InChIKey | AGUJSWLBNXLQDX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |