About 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride
1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride (PubChem CID 6366881) has the molecular formula C8H14ClN3O3
and a molecular weight of 235.67 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride |
| PubChem CID | 6366881 |
| Molecular Formula | C8H14ClN3O3 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride |
| SMILES | CN(C)CCN1C(=O)C(=O)N(C)C1=O.Cl |
| InChI | InChI=1S/C8H13N3O3.ClH/c1-9(2)4-5-11-7(13)6(12)10(3)8(11)14;/h4-5H2,1-3H3;1H |
| InChIKey | RTMJFPXCFIWCOE-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride (CID 6366881) is 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride is CN(C)CCN1C(=O)C(=O)N(C)C1=O.Cl.
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride?
The InChIKey is RTMJFPXCFIWCOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3.ClH/c1-9(2)4-5-11-7(13)6(12)10(3)8(11)14;/h4-5H2,1-3H3;1H.
What are the key properties of 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride?
1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride has a molecular weight of 235.67 g/mol, XLogP of -0.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride is sourced from PubChem (CID 6366881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).