C11H17N3O5S — CID 63669790
3-(3-ethoxy-4-nitroanilino)propane-1-sulfonamide (PubChem CID 63669790) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-(3-ethoxy-4-nitroanilino)propane-1-sulfonamide.
| Compound Name | 3-(3-ethoxy-4-nitroanilino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 63669790 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-(3-ethoxy-4-nitroanilino)propane-1-sulfonamide |
| SMILES | CCOc1cc(NCCCS(N)(=O)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O5S/c1-2-19-11-8-9(4-5-10(11)14(15)16)13-6-3-7-20(12,17)18/h4-5,8,13H,2-3,6-7H2,1H3,(H2,12,17,18) |
| InChIKey | BWEINJXYXUJBDK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|