C35H52O5 — CID 636711
(1S,3S,5S,6R,7S)-3-hydroxy-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 636711) has the molecular formula C35H52O5 and a molecular weight of 552.80 g/mol. Its IUPAC name is (1S,3S,5S,6R,7S)-3-hydroxy-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1S,3S,5S,6R,7S)-3-hydroxy-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 636711 |
| Molecular Formula | C35H52O5 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (1S,3S,5S,6R,7S)-3-hydroxy-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@@](O)(CC=C(C)C)C(=O)[C@@]1(C(=O)C(C)C)C2=O |
| InChI | InChI=1S/C35H52O5/c1-22(2)13-12-18-32(11)27(15-14-23(3)4)21-33(19-16-24(5)6)29(37)34(40,20-17-25(7)8)31(39)35(32,30(33)38)28(36)26(9)10/h13-14,16-17,26-27,40H,12,15,18-21H2,1-11H3/t27-,32+,33+,34-,35+/m0/s1 |
| InChIKey | YCLWQYWJILHRAA-KJBKQBOQSA-N |
| XLogP | 7.48 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|