C13H22N2O — CID 63671140
4-N-methyl-2-propoxy-4-N-propylbenzene-1,4-diamine (PubChem CID 63671140) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-N-methyl-2-propoxy-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-methyl-2-propoxy-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63671140 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-N-methyl-2-propoxy-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCOc1cc(N(C)CCC)ccc1N |
| InChI | InChI=1S/C13H22N2O/c1-4-8-15(3)11-6-7-12(14)13(10-11)16-9-5-2/h6-7,10H,4-5,8-9,14H2,1-3H3 |
| InChIKey | GCKVKYBGVFMHDJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|