C30H35O6Si — CID 6367163
4,14-Dioxo-7,9,11-triphenyl-3,8,10,15-tetraoxa-9-silaheptadecan-9-yl (PubChem CID 6367163) has the molecular formula C30H35O6Si and a molecular weight of 519.69 g/mol.
| Compound Name | 4,14-Dioxo-7,9,11-triphenyl-3,8,10,15-tetraoxa-9-silaheptadecan-9-yl |
|---|---|
| PubChem CID | 6367163 |
| Molecular Formula | C30H35O6Si |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CCC(O[Si](OC(CCC(=O)OCC)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35O6Si/c1-3-33-29(31)22-20-27(24-14-8-5-9-15-24)35-37(26-18-12-7-13-19-26)36-28(21-23-30(32)34-4-2)25-16-10-6-11-17-25/h5-19,27-28H,3-4,20-23H2,1-2H3 |
| InChIKey | WHCKFWSNRDLZIY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|