C18H28O2 — CID 636719
methyl (2E,4E,6S,8E,10E,12S)-6,9,12-trimethyltetradeca-2,4,8,10-tetraenoate (PubChem CID 636719) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is methyl (2E,4E,6S,8E,10E,12S)-6,9,12-trimethyltetradeca-2,4,8,10-tetraenoate.
| Compound Name | methyl (2E,4E,6S,8E,10E,12S)-6,9,12-trimethyltetradeca-2,4,8,10-tetraenoate |
|---|---|
| PubChem CID | 636719 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | methyl (2E,4E,6S,8E,10E,12S)-6,9,12-trimethyltetradeca-2,4,8,10-tetraenoate |
| SMILES | CC[C@H](C)/C=C/C(C)=C/C[C@H](C)/C=C/C=C/C(=O)OC |
| InChI | InChI=1S/C18H28O2/c1-6-15(2)11-12-17(4)14-13-16(3)9-7-8-10-18(19)20-5/h7-12,14-16H,6,13H2,1-5H3/b9-7+,10-8+,12-11+,17-14+/t15-,16+/m0/s1 |
| InChIKey | DLNJQMUZKSNTET-JMXAGWQHSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|