C12H17N3O3 — CID 63672015
N-cyclopropyl-N'-(3-methoxy-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 63672015) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-cyclopropyl-N'-(3-methoxy-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(3-methoxy-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63672015 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-cyclopropyl-N'-(3-methoxy-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNC2CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O3/c1-18-12-8-10(4-5-11(12)15(16)17)14-7-6-13-9-2-3-9/h4-5,8-9,13-14H,2-3,6-7H2,1H3 |
| InChIKey | XGJLKPXAJCWTFU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|