About [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine
[5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine (PubChem CID 63672826) has the molecular formula C9H8FN3S2
and a molecular weight of 241.32 g/mol. Its IUPAC name is [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine |
| PubChem CID | 63672826 |
| Molecular Formula | C9H8FN3S2 |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1Sc1nncs1 |
| InChI | InChI=1S/C9H8FN3S2/c10-7-1-2-8(6(3-7)4-11)15-9-13-12-5-14-9/h1-3,5H,4,11H2 |
| InChIKey | TVHGQQOSXDMNFT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine?
The IUPAC name of [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine (CID 63672826) is [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine.
What is the SMILES notation for [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine?
The canonical SMILES for [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine is NCc1cc(F)ccc1Sc1nncs1.
What is the InChIKey of [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine?
The InChIKey is TVHGQQOSXDMNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3S2/c10-7-1-2-8(6(3-7)4-11)15-9-13-12-5-14-9/h1-3,5H,4,11H2.
What are the key properties of [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine?
[5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine has a molecular weight of 241.32 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]methanamine is sourced from PubChem (CID 63672826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).