C14H20N4O2S — CID 63676563
3-(4-amino-3-propoxyphenyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 63676563) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-(4-amino-3-propoxyphenyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(4-amino-3-propoxyphenyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 63676563 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-(4-amino-3-propoxyphenyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCOc1cc(Sc2n[nH]c(=O)n2CCC)ccc1N |
| InChI | InChI=1S/C14H20N4O2S/c1-3-7-18-13(19)16-17-14(18)21-10-5-6-11(15)12(9-10)20-8-4-2/h5-6,9H,3-4,7-8,15H2,1-2H3,(H,16,19) |
| InChIKey | GYLRDZCSCUZNOI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|