C13H16FN3O3S — CID 63676566
N-(4-fluoro-2-hydroxyphenyl)-2-methyl-1-propylimidazole-4-sulfonamide (PubChem CID 63676566) has the molecular formula C13H16FN3O3S and a molecular weight of 313.35 g/mol. Its IUPAC name is N-(4-fluoro-2-hydroxyphenyl)-2-methyl-1-propylimidazole-4-sulfonamide.
| Compound Name | N-(4-fluoro-2-hydroxyphenyl)-2-methyl-1-propylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 63676566 |
| Molecular Formula | C13H16FN3O3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(4-fluoro-2-hydroxyphenyl)-2-methyl-1-propylimidazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)Nc2ccc(F)cc2O)nc1C |
| InChI | InChI=1S/C13H16FN3O3S/c1-3-6-17-8-13(15-9(17)2)21(19,20)16-11-5-4-10(14)7-12(11)18/h4-5,7-8,16,18H,3,6H2,1-2H3 |
| InChIKey | AHBZWHXRLBOBJL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|