About 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine
2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine (PubChem CID 63676578) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine.
Molecular Properties
| Compound Name | 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine |
| PubChem CID | 63676578 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine |
| SMILES | CC(C)(N)c1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C10H11FN2O/c1-10(2,12)9-13-7-4-3-6(11)5-8(7)14-9/h3-5H,12H2,1-2H3 |
| InChIKey | GZOVIOHZVFZDHO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine?
The IUPAC name of 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine (CID 63676578) is 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine.
What is the SMILES notation for 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine?
The canonical SMILES for 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine is CC(C)(N)c1nc2ccc(F)cc2o1.
What is the InChIKey of 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine?
The InChIKey is GZOVIOHZVFZDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O/c1-10(2,12)9-13-7-4-3-6(11)5-8(7)14-9/h3-5H,12H2,1-2H3.
What are the key properties of 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine?
2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine has a molecular weight of 194.21 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-1,3-benzoxazol-2-yl)propan-2-amine is sourced from PubChem (CID 63676578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).