C21H13ClN2O5 — CID 6367665
4-[5-[(E)-[1-(4-chlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 6367665) has the molecular formula C21H13ClN2O5 and a molecular weight of 408.80 g/mol. Its IUPAC name is 4-[5-[(E)-[1-(4-chlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-[1-(4-chlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6367665 |
| Molecular Formula | C21H13ClN2O5 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 4-[5-[(E)-[1-(4-chlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1NN(c2ccc(Cl)cc2)C(=O)/C1=C/c1ccc(-c2ccc(C(=O)O)cc2)o1 |
| InChI | InChI=1S/C21H13ClN2O5/c22-14-5-7-15(8-6-14)24-20(26)17(19(25)23-24)11-16-9-10-18(29-16)12-1-3-13(4-2-12)21(27)28/h1-11H,(H,23,25)(H,27,28)/b17-11+ |
| InChIKey | CWGRXFKQAMAUHJ-GZTJUZNOSA-N |
| XLogP | 3.76 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|