About N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide
N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide (PubChem CID 63679965) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide |
| PubChem CID | 63679965 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide |
| SMILES | CCC(C)N(C)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C10H20ClNO/c1-6-8(2)12(5)9(13)10(3,4)7-11/h8H,6-7H2,1-5H3 |
| InChIKey | BRNLUXBOTYDNNR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide?
The IUPAC name of N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide (CID 63679965) is N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide?
The canonical SMILES for N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide is CCC(C)N(C)C(=O)C(C)(C)CCl.
What is the InChIKey of N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide?
The InChIKey is BRNLUXBOTYDNNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO/c1-6-8(2)12(5)9(13)10(3,4)7-11/h8H,6-7H2,1-5H3.
What are the key properties of N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide?
N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide has a molecular weight of 205.73 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3-chloro-N,2,2-trimethylpropanamide is sourced from PubChem (CID 63679965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).