C15H21ClN2O2 — CID 63680386
3-chloro-2,2-dimethyl-N-[2-methyl-3-(propanoylamino)phenyl]propanamide (PubChem CID 63680386) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[2-methyl-3-(propanoylamino)phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[2-methyl-3-(propanoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 63680386 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[2-methyl-3-(propanoylamino)phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)C(C)(C)CCl)c1C |
| InChI | InChI=1S/C15H21ClN2O2/c1-5-13(19)17-11-7-6-8-12(10(11)2)18-14(20)15(3,4)9-16/h6-8H,5,9H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | QBUHJDWSVICEJU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|