About 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide
3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 63680566) has the molecular formula C13H19ClN2O3
and a molecular weight of 286.76 g/mol. Its IUPAC name is 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide |
| PubChem CID | 63680566 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | COCCn1cc(NC(=O)C(C)(C)CCl)ccc1=O |
| InChI | InChI=1S/C13H19ClN2O3/c1-13(2,9-14)12(18)15-10-4-5-11(17)16(8-10)6-7-19-3/h4-5,8H,6-7,9H2,1-3H3,(H,15,18) |
| InChIKey | FJMJOLOQQBOAFM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide?
The IUPAC name of 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide (CID 63680566) is 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide.
What is the SMILES notation for 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide?
The canonical SMILES for 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide is COCCn1cc(NC(=O)C(C)(C)CCl)ccc1=O.
What is the InChIKey of 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide?
The InChIKey is FJMJOLOQQBOAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2O3/c1-13(2,9-14)12(18)15-10-4-5-11(17)16(8-10)6-7-19-3/h4-5,8H,6-7,9H2,1-3H3,(H,15,18).
What are the key properties of 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide?
3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide has a molecular weight of 286.76 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 63680566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).