C12H23ClN2O — CID 63680576
3-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 63680576) has the molecular formula C12H23ClN2O and a molecular weight of 246.78 g/mol. Its IUPAC name is 3-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63680576 |
| Molecular Formula | C12H23ClN2O |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | CCN1CCC(CNC(=O)C(C)(C)CCl)C1 |
| InChI | InChI=1S/C12H23ClN2O/c1-4-15-6-5-10(8-15)7-14-11(16)12(2,3)9-13/h10H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | LYSKFCAUYOURKS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|