About CID 6368102
CID 6368102 (PubChem CID 6368102) has the molecular formula C13H20BrO2Pb
and a molecular weight of 495.41 g/mol.
Molecular Properties
| Compound Name | CID 6368102 |
| PubChem CID | 6368102 |
| Molecular Formula | C13H20BrO2Pb |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | — |
| SMILES | CC[Pb](CC)CC.O=C(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C7H5BrO2.3C2H5.Pb/c8-6-3-1-2-5(4-6)7(9)10;3*1-2;/h1-4H,(H,9,10);3*1H2,2H3; |
| InChIKey | MFTNKMKKLDUCQH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 6368102 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6368102?
The IUPAC name of CID 6368102 (CID 6368102) is not available.
What is the SMILES notation for CID 6368102?
The canonical SMILES for CID 6368102 is CC[Pb](CC)CC.O=C(O)c1cccc(Br)c1.
What is the InChIKey of CID 6368102?
The InChIKey is MFTNKMKKLDUCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO2.3C2H5.Pb/c8-6-3-1-2-5(4-6)7(9)10;3*1-2;/h1-4H,(H,9,10);3*1H2,2H3;.
What are the key properties of CID 6368102?
CID 6368102 has a molecular weight of 495.41 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6368102 is sourced from PubChem (CID 6368102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).