C11H10BrN3O2 — CID 63681213
2-bromo-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]acetamide (PubChem CID 63681213) has the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. Its IUPAC name is 2-bromo-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-bromo-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 63681213 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 2-bromo-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]acetamide |
| SMILES | Cc1cc(-c2nnco2)ccc1NC(=O)CBr |
| InChI | InChI=1S/C11H10BrN3O2/c1-7-4-8(11-15-13-6-17-11)2-3-9(7)14-10(16)5-12/h2-4,6H,5H2,1H3,(H,14,16) |
| InChIKey | BLZZBPHXQWEVAL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|