C22H21N3O3 — CID 6368130
N-[2-[(2Z)-2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 6368130) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[(2Z)-2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 6368130 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[2-[(2Z)-2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | C/C(=N/NC(=O)CNC(=O)C(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H21N3O3/c1-16(19-13-8-14-28-19)24-25-20(26)15-23-22(27)21(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-14,21H,15H2,1H3,(H,23,27)(H,25,26)/b24-16- |
| InChIKey | FGGMKQHQELOAIC-JLPGSUDCSA-N |
| XLogP | 3.07 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|