C13H24ClN3O2 — CID 63681324
2-[4-(3-chloro-2,2-dimethylpropanoyl)piperazin-1-yl]-N-ethylacetamide (PubChem CID 63681324) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-[4-(3-chloro-2,2-dimethylpropanoyl)piperazin-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-(3-chloro-2,2-dimethylpropanoyl)piperazin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 63681324 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[4-(3-chloro-2,2-dimethylpropanoyl)piperazin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(C(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C13H24ClN3O2/c1-4-15-11(18)9-16-5-7-17(8-6-16)12(19)13(2,3)10-14/h4-10H2,1-3H3,(H,15,18) |
| InChIKey | BNOOJENZZZOCOZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|