C10H17BrN2O3 — CID 63681407
2-bromo-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide (PubChem CID 63681407) has the molecular formula C10H17BrN2O3 and a molecular weight of 293.16 g/mol. Its IUPAC name is 2-bromo-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide.
| Compound Name | 2-bromo-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 63681407 |
| Molecular Formula | C10H17BrN2O3 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-bromo-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide |
| SMILES | COCC(=O)N1CCC(NC(=O)CBr)CC1 |
| InChI | InChI=1S/C10H17BrN2O3/c1-16-7-10(15)13-4-2-8(3-5-13)12-9(14)6-11/h8H,2-7H2,1H3,(H,12,14) |
| InChIKey | UXRPECBTSRTNMU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|