About Phosphopropanol
Phosphopropanol (PubChem CID 6368229) has the molecular formula C3H7O3P
and a molecular weight of 122.06 g/mol.
Molecular Properties
| Compound Name | Phosphopropanol |
| PubChem CID | 6368229 |
| Molecular Formula | C3H7O3P |
| Molecular Weight | 122.06 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | — |
| SMILES | CCCOP(=O)=O |
| InChI | InChI=1S/C3H7O3P/c1-2-3-6-7(4)5/h2-3H2,1H3 |
| InChIKey | OWBGZFRYOBBPOG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.06 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Phosphopropanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phosphopropanol?
The IUPAC name of Phosphopropanol (CID 6368229) is not available.
What is the SMILES notation for Phosphopropanol?
The canonical SMILES for Phosphopropanol is CCCOP(=O)=O.
What is the InChIKey of Phosphopropanol?
The InChIKey is OWBGZFRYOBBPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O3P/c1-2-3-6-7(4)5/h2-3H2,1H3.
What are the key properties of Phosphopropanol?
Phosphopropanol has a molecular weight of 122.06 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Phosphopropanol is sourced from PubChem (CID 6368229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).