C12H21NO2 — CID 63682304
3-(2-bicyclo[2.2.1]heptanylmethylamino)-2-methylpropanoic acid (PubChem CID 63682304) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylmethylamino)-2-methylpropanoic acid.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylmethylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 63682304 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylmethylamino)-2-methylpropanoic acid |
| SMILES | CC(CNCC1CC2CCC1C2)C(=O)O |
| InChI | InChI=1S/C12H21NO2/c1-8(12(14)15)6-13-7-11-5-9-2-3-10(11)4-9/h8-11,13H,2-7H2,1H3,(H,14,15) |
| InChIKey | SBODMFDFCZTPPD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |